C11H9Br2NO4S — CID 79274452
2-[(2,5-dibromophenyl)sulfonyl-prop-2-ynylamino]acetic acid (PubChem CID 79274452) has the molecular formula C11H9Br2NO4S and a molecular weight of 411.07 g/mol. Its IUPAC name is 2-[(2,5-dibromophenyl)sulfonyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(2,5-dibromophenyl)sulfonyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79274452 |
| Molecular Formula | C11H9Br2NO4S |
| Molecular Weight | 411.07 g/mol |
| Exact Mass | 408.86 |
| IUPAC Name | 2-[(2,5-dibromophenyl)sulfonyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H9Br2NO4S/c1-2-5-14(7-11(15)16)19(17,18)10-6-8(12)3-4-9(10)13/h1,3-4,6H,5,7H2,(H,15,16) |
| InChIKey | FNMKFCNCFGPQPC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|