C10H11NO4S2 — CID 79272902
2-[(5-methylthiophen-2-yl)sulfonyl-prop-2-ynylamino]acetic acid (PubChem CID 79272902) has the molecular formula C10H11NO4S2 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[(5-methylthiophen-2-yl)sulfonyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(5-methylthiophen-2-yl)sulfonyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79272902 |
| Molecular Formula | C10H11NO4S2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-[(5-methylthiophen-2-yl)sulfonyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)S(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C10H11NO4S2/c1-3-6-11(7-9(12)13)17(14,15)10-5-4-8(2)16-10/h1,4-5H,6-7H2,2H3,(H,12,13) |
| InChIKey | YTZQVYSKATWUCR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|