C10H8N2O4S2 — CID 114208701
5-[cyanomethyl(prop-2-ynyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 114208701) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-[cyanomethyl(prop-2-ynyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[cyanomethyl(prop-2-ynyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114208701 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 5-[cyanomethyl(prop-2-ynyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | C#CCN(CC#N)S(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H8N2O4S2/c1-2-6-12(7-5-11)18(15,16)9-4-3-8(17-9)10(13)14/h1,3-4H,6-7H2,(H,13,14) |
| InChIKey | AUMGUMGMNMJLHR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|