C26H22N6O9S3 — CID 21022750
4-[[4-[(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 21022750) has the molecular formula C26H22N6O9S3 and a molecular weight of 658.70 g/mol. Its IUPAC name is 4-[[4-[(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-[(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21022750 |
| Molecular Formula | C26H22N6O9S3 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.06 |
| IUPAC Name | 4-[[4-[(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Cc1c(O)ccc2cc(S(=O)(=O)Nc3nc(Nc4ccc(S(=O)(=O)O)cc4)nc(Nc4ccc(S(=O)(=O)O)cc4)n3)ccc12 |
| InChI | InChI=1S/C26H22N6O9S3/c1-15-22-12-11-21(14-16(22)2-13-23(15)33)42(34,35)32-26-30-24(27-17-3-7-19(8-4-17)43(36,37)38)29-25(31-26)28-18-5-9-20(10-6-18)44(39,40)41/h2-14,33H,1H3,(H,36,37,38)(H,39,40,41)(H3,27,28,29,30,31,32) |
| InChIKey | IWQHRHKSPISDPK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 237.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|