C10H8NO4S- — CID 57134913
1,7-dihydroxy-3-(sulfinatoamino)naphthalene (PubChem CID 57134913) has the molecular formula C10H8NO4S- and a molecular weight of 238.24 g/mol. Its IUPAC name is 1,7-dihydroxy-3-(sulfinatoamino)naphthalene.
| Compound Name | 1,7-dihydroxy-3-(sulfinatoamino)naphthalene |
|---|---|
| PubChem CID | 57134913 |
| Molecular Formula | C10H8NO4S- |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1,7-dihydroxy-3-(sulfinatoamino)naphthalene |
| SMILES | O=S([O-])Nc1cc(O)c2cc(O)ccc2c1 |
| InChI | InChI=1S/C10H9NO4S/c12-8-2-1-6-3-7(11-16(14)15)4-10(13)9(6)5-8/h1-5,11-13H,(H,14,15)/p-1 |
| InChIKey | UHMSQJPJPFKWTQ-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|