C10H7O5S- — CID 19096570
4,6-dihydroxynaphthalene-2-sulfonate (PubChem CID 19096570) has the molecular formula C10H7O5S- and a molecular weight of 239.23 g/mol. Its IUPAC name is 4,6-dihydroxynaphthalene-2-sulfonate.
| Compound Name | 4,6-dihydroxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 19096570 |
| Molecular Formula | C10H7O5S- |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 4,6-dihydroxynaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)c2cc(O)ccc2c1 |
| InChI | InChI=1S/C10H8O5S/c11-7-2-1-6-3-8(16(13,14)15)5-10(12)9(6)4-7/h1-5,11-12H,(H,13,14,15)/p-1 |
| InChIKey | FBYMBFPXCCVIRA-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|