C20H14O5 — CID 146469077
1-(2,7-dihydroxynaphthalen-1-yl)oxynaphthalene-2,7-diol (PubChem CID 146469077) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(2,7-dihydroxynaphthalen-1-yl)oxynaphthalene-2,7-diol.
| Compound Name | 1-(2,7-dihydroxynaphthalen-1-yl)oxynaphthalene-2,7-diol |
|---|---|
| PubChem CID | 146469077 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-(2,7-dihydroxynaphthalen-1-yl)oxynaphthalene-2,7-diol |
| SMILES | Oc1ccc2ccc(O)c(Oc3c(O)ccc4ccc(O)cc34)c2c1 |
| InChI | InChI=1S/C20H14O5/c21-13-5-1-11-3-7-17(23)19(15(11)9-13)25-20-16-10-14(22)6-2-12(16)4-8-18(20)24/h1-10,21-24H |
| InChIKey | UZWRSMKVOXIZJU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |