C16H12O2 — CID 118054370
1-phenylnaphthalene-2,7-diol (PubChem CID 118054370) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-phenylnaphthalene-2,7-diol.
| Compound Name | 1-phenylnaphthalene-2,7-diol |
|---|---|
| PubChem CID | 118054370 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-phenylnaphthalene-2,7-diol |
| SMILES | Oc1ccc2ccc(O)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C16H12O2/c17-13-8-6-11-7-9-15(18)16(14(11)10-13)12-4-2-1-3-5-12/h1-10,17-18H |
| InChIKey | ROYOSTMSSNHSRO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |