C34H26O3 — CID 134202853
1-[1-(7-hydroxynaphthalen-1-yl)-1-(4-phenylphenyl)ethyl]naphthalene-2,7-diol (PubChem CID 134202853) has the molecular formula C34H26O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-[1-(7-hydroxynaphthalen-1-yl)-1-(4-phenylphenyl)ethyl]naphthalene-2,7-diol.
| Compound Name | 1-[1-(7-hydroxynaphthalen-1-yl)-1-(4-phenylphenyl)ethyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 134202853 |
| Molecular Formula | C34H26O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[1-(7-hydroxynaphthalen-1-yl)-1-(4-phenylphenyl)ethyl]naphthalene-2,7-diol |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)(c1cccc2ccc(O)cc12)c1c(O)ccc2ccc(O)cc12 |
| InChI | InChI=1S/C34H26O3/c1-34(31-9-5-8-24-12-17-27(35)20-29(24)31,26-15-10-23(11-16-26)22-6-3-2-4-7-22)33-30-21-28(36)18-13-25(30)14-19-32(33)37/h2-21,35-37H,1H3 |
| InChIKey | HIXJXLJUODHJFR-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|