About 6-iodo-1-benzofuran-3-ol
6-iodo-1-benzofuran-3-ol (PubChem CID 123196484) has the molecular formula C8H5IO2
and a molecular weight of 260.03 g/mol. Its IUPAC name is 6-iodo-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | 6-iodo-1-benzofuran-3-ol |
| PubChem CID | 123196484 |
| Molecular Formula | C8H5IO2 |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 6-iodo-1-benzofuran-3-ol |
| SMILES | Oc1coc2cc(I)ccc12 |
| InChI | InChI=1S/C8H5IO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-4,10H |
| InChIKey | NZPTXVYGEREGLM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-1-benzofuran-3-ol?
The IUPAC name of 6-iodo-1-benzofuran-3-ol (CID 123196484) is 6-iodo-1-benzofuran-3-ol.
What is the SMILES notation for 6-iodo-1-benzofuran-3-ol?
The canonical SMILES for 6-iodo-1-benzofuran-3-ol is Oc1coc2cc(I)ccc12.
What is the InChIKey of 6-iodo-1-benzofuran-3-ol?
The InChIKey is NZPTXVYGEREGLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-4,10H.
What are the key properties of 6-iodo-1-benzofuran-3-ol?
6-iodo-1-benzofuran-3-ol has a molecular weight of 260.03 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-1-benzofuran-3-ol is sourced from PubChem (CID 123196484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).