C14H8O2S — CID 90693003
[1]benzothiolo[2,3-f][1]benzofuran-1-ol (PubChem CID 90693003) has the molecular formula C14H8O2S and a molecular weight of 240.28 g/mol. Its IUPAC name is [1]benzothiolo[2,3-f][1]benzofuran-1-ol.
| Compound Name | [1]benzothiolo[2,3-f][1]benzofuran-1-ol |
|---|---|
| PubChem CID | 90693003 |
| Molecular Formula | C14H8O2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | [1]benzothiolo[2,3-f][1]benzofuran-1-ol |
| SMILES | Oc1coc2cc3c(cc12)sc1ccccc13 |
| InChI | InChI=1S/C14H8O2S/c15-11-7-16-12-5-9-8-3-1-2-4-13(8)17-14(9)6-10(11)12/h1-7,15H |
| InChIKey | PWXZBRUBEKEBHY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |