C6H3I3O — CID 18369900
2,4,5-triiodophenol (PubChem CID 18369900) has the molecular formula C6H3I3O and a molecular weight of 471.80 g/mol. Its IUPAC name is 2,4,5-triiodophenol.
| Compound Name | 2,4,5-triiodophenol |
|---|---|
| PubChem CID | 18369900 |
| Molecular Formula | C6H3I3O |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 471.73 |
| IUPAC Name | 2,4,5-triiodophenol |
| SMILES | Oc1cc(I)c(I)cc1I |
| InChI | InChI=1S/C6H3I3O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
| InChIKey | HMPJHNVNSAMGSU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|