C10H11IO3 — CID 118327186
1-(2,5-dihydroxy-4-iodophenyl)butan-1-one (PubChem CID 118327186) has the molecular formula C10H11IO3 and a molecular weight of 306.10 g/mol. Its IUPAC name is 1-(2,5-dihydroxy-4-iodophenyl)butan-1-one.
| Compound Name | 1-(2,5-dihydroxy-4-iodophenyl)butan-1-one |
|---|---|
| PubChem CID | 118327186 |
| Molecular Formula | C10H11IO3 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1-(2,5-dihydroxy-4-iodophenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(O)c(I)cc1O |
| InChI | InChI=1S/C10H11IO3/c1-2-3-8(12)6-4-10(14)7(11)5-9(6)13/h4-5,13-14H,2-3H2,1H3 |
| InChIKey | FPTADAVQFRPOCI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|