C12H16O2 — CID 81251881
1-(4-hydroxy-2,5-dimethylphenyl)butan-1-one (PubChem CID 81251881) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(4-hydroxy-2,5-dimethylphenyl)butan-1-one.
| Compound Name | 1-(4-hydroxy-2,5-dimethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 81251881 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1-(4-hydroxy-2,5-dimethylphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C12H16O2/c1-4-5-11(13)10-6-9(3)12(14)7-8(10)2/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | FZAOSFFSHBBYCE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |