C12H16OS — CID 116830773
3-sulfanyl-1-(2,4,5-trimethylphenyl)propan-1-one (PubChem CID 116830773) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 3-sulfanyl-1-(2,4,5-trimethylphenyl)propan-1-one.
| Compound Name | 3-sulfanyl-1-(2,4,5-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 116830773 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-sulfanyl-1-(2,4,5-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)CCS)cc1C |
| InChI | InChI=1S/C12H16OS/c1-8-6-10(3)11(7-9(8)2)12(13)4-5-14/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | UZZLPKQVIHPORO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|