5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid

C14H18O3 — CID 24727183

IUPAC5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid
SMILESCc1cc(C)c(C(=O)CCCC(=O)O)cc1C
InChIInChI=1S/C14H18O3/c1-9-7-11(3)12(8-10(9)2)13(15)5-4-6-14(16)17/h7-8H,4-6H2,1-3H3,(H,16,17)
InChIKeyBBXPVCIIYHYCKW-UHFFFAOYSA-N
MW234.29 g/mol
LogP3.05
Rot. Bonds5

About 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid

5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid (PubChem CID 24727183) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid.

Molecular Properties

Compound Name5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid
PubChem CID24727183
Molecular FormulaC14H18O3
Molecular Weight234.29 g/mol
Exact Mass234.13
IUPAC Name5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid
SMILESCc1cc(C)c(C(=O)CCCC(=O)O)cc1C
InChIInChI=1S/C14H18O3/c1-9-7-11(3)12(8-10(9)2)13(15)5-4-6-14(16)17/h7-8H,4-6H2,1-3H3,(H,16,17)
InChIKeyBBXPVCIIYHYCKW-UHFFFAOYSA-N
XLogP3.05
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.29
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid?
The IUPAC name of 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid (CID 24727183) is 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid.
What is the SMILES notation for 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid?
The canonical SMILES for 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid is Cc1cc(C)c(C(=O)CCCC(=O)O)cc1C.
What is the InChIKey of 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid?
The InChIKey is BBXPVCIIYHYCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-9-7-11(3)12(8-10(9)2)13(15)5-4-6-14(16)17/h7-8H,4-6H2,1-3H3,(H,16,17).
What are the key properties of 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid?
5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid has a molecular weight of 234.29 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid is sourced from PubChem (CID 24727183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).