C14H18O3 — CID 24727183
5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid (PubChem CID 24727183) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid.
| Compound Name | 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 24727183 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 5-oxo-5-(2,4,5-trimethylphenyl)pentanoic acid |
| SMILES | Cc1cc(C)c(C(=O)CCCC(=O)O)cc1C |
| InChI | InChI=1S/C14H18O3/c1-9-7-11(3)12(8-10(9)2)13(15)5-4-6-14(16)17/h7-8H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | BBXPVCIIYHYCKW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |