About 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene
4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene (PubChem CID 139202655) has the molecular formula C16H12I2N4O2
and a molecular weight of 546.11 g/mol. Its IUPAC name is 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene.
Molecular Properties
| Compound Name | 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene |
| PubChem CID | 139202655 |
| Molecular Formula | C16H12I2N4O2 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.90 |
| IUPAC Name | 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene |
| SMILES | Oc1cc(O)c(I)cc1I.c1cc(/N=N/c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N4.C6H4I2O2/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10;7-3-1-4(8)6(10)2-5(3)9/h1-8H;1-2,9-10H/b14-13+; |
| InChIKey | NWVIPMYUGNVROG-IERUDJENSA-N |
| XLogP | 5.20 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene?
The IUPAC name of 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene (CID 139202655) is 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene.
What is the SMILES notation for 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene?
The canonical SMILES for 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene is Oc1cc(O)c(I)cc1I.c1cc(/N=N/c2ccncc2)ccn1.
What is the InChIKey of 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene?
The InChIKey is NWVIPMYUGNVROG-IERUDJENSA-N. The full InChI is InChI=1S/C10H8N4.C6H4I2O2/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10;7-3-1-4(8)6(10)2-5(3)9/h1-8H;1-2,9-10H/b14-13+;.
What are the key properties of 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene?
4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene has a molecular weight of 546.11 g/mol, XLogP of 5.20, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diiodobenzene-1,3-diol;dipyridin-4-yldiazene is sourced from PubChem (CID 139202655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).