C12H3Cl5F2O — CID 118800996
4,5-difluoro-2-(2,3,4,5,6-pentachlorophenyl)phenol (PubChem CID 118800996) has the molecular formula C12H3Cl5F2O and a molecular weight of 378.42 g/mol. Its IUPAC name is 4,5-difluoro-2-(2,3,4,5,6-pentachlorophenyl)phenol.
| Compound Name | 4,5-difluoro-2-(2,3,4,5,6-pentachlorophenyl)phenol |
|---|---|
| PubChem CID | 118800996 |
| Molecular Formula | C12H3Cl5F2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | 4,5-difluoro-2-(2,3,4,5,6-pentachlorophenyl)phenol |
| SMILES | Oc1cc(F)c(F)cc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl5F2O/c13-8-7(9(14)11(16)12(17)10(8)15)3-1-4(18)5(19)2-6(3)20/h1-2,20H |
| InChIKey | GIKAYIZCQMNDBZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|