C13H2Cl7FO — CID 134629641
2-chloro-5-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoyl chloride (PubChem CID 134629641) has the molecular formula C13H2Cl7FO and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-chloro-5-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoyl chloride.
| Compound Name | 2-chloro-5-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoyl chloride |
|---|---|
| PubChem CID | 134629641 |
| Molecular Formula | C13H2Cl7FO |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 437.79 |
| IUPAC Name | 2-chloro-5-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoyl chloride |
| SMILES | O=C(Cl)c1cc(F)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C13H2Cl7FO/c14-5-1-4(6(21)2-3(5)13(20)22)7-8(15)10(17)12(19)11(18)9(7)16/h1-2H |
| InChIKey | QSUDOLYPUCAWPU-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|