C7HCl3F2O3S — CID 116739950
3-chloro-5-chlorosulfonyl-2,4-difluorobenzoyl chloride (PubChem CID 116739950) has the molecular formula C7HCl3F2O3S and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-chloro-5-chlorosulfonyl-2,4-difluorobenzoyl chloride.
| Compound Name | 3-chloro-5-chlorosulfonyl-2,4-difluorobenzoyl chloride |
|---|---|
| PubChem CID | 116739950 |
| Molecular Formula | C7HCl3F2O3S |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 307.87 |
| IUPAC Name | 3-chloro-5-chlorosulfonyl-2,4-difluorobenzoyl chloride |
| SMILES | O=C(Cl)c1cc(S(=O)(=O)Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C7HCl3F2O3S/c8-4-5(11)2(7(9)13)1-3(6(4)12)16(10,14)15/h1H |
| InChIKey | QSJHPQRMRSDGJO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|