C6HClF4O2S — CID 22326053
2,3,4,5-tetrafluorobenzenesulfonyl chloride (PubChem CID 22326053) has the molecular formula C6HClF4O2S and a molecular weight of 248.58 g/mol. Its IUPAC name is 2,3,4,5-tetrafluorobenzenesulfonyl chloride.
| Compound Name | 2,3,4,5-tetrafluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 22326053 |
| Molecular Formula | C6HClF4O2S |
| Molecular Weight | 248.58 g/mol |
| Exact Mass | 247.93 |
| IUPAC Name | 2,3,4,5-tetrafluorobenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HClF4O2S/c7-14(12,13)3-1-2(8)4(9)6(11)5(3)10/h1H |
| InChIKey | RLVBQZRXFSRXFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|