C7H4ClF2NO4S — CID 131613440
4,5-difluoro-2-methyl-3-nitrobenzenesulfonyl chloride (PubChem CID 131613440) has the molecular formula C7H4ClF2NO4S and a molecular weight of 271.63 g/mol. Its IUPAC name is 4,5-difluoro-2-methyl-3-nitrobenzenesulfonyl chloride.
| Compound Name | 4,5-difluoro-2-methyl-3-nitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 131613440 |
| Molecular Formula | C7H4ClF2NO4S |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 4,5-difluoro-2-methyl-3-nitrobenzenesulfonyl chloride |
| SMILES | Cc1c(S(=O)(=O)Cl)cc(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4ClF2NO4S/c1-3-5(16(8,14)15)2-4(9)6(10)7(3)11(12)13/h2H,1H3 |
| InChIKey | MDEYBPQMOUZVBA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|