C6H2Cl2F2O2S — CID 131077106
4-chloro-2,3-difluorobenzenesulfonyl chloride (PubChem CID 131077106) has the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. Its IUPAC name is 4-chloro-2,3-difluorobenzenesulfonyl chloride.
| Compound Name | 4-chloro-2,3-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 131077106 |
| Molecular Formula | C6H2Cl2F2O2S |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 4-chloro-2,3-difluorobenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C6H2Cl2F2O2S/c7-3-1-2-4(13(8,11)12)6(10)5(3)9/h1-2H |
| InChIKey | WFUYHAFUHLSJPD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|