C7H5ClF2O3S — CID 84703410
2,4-difluoro-3-methoxybenzenesulfonyl chloride (PubChem CID 84703410) has the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. Its IUPAC name is 2,4-difluoro-3-methoxybenzenesulfonyl chloride.
| Compound Name | 2,4-difluoro-3-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 84703410 |
| Molecular Formula | C7H5ClF2O3S |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 2,4-difluoro-3-methoxybenzenesulfonyl chloride |
| SMILES | COc1c(F)ccc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C7H5ClF2O3S/c1-13-7-4(9)2-3-5(6(7)10)14(8,11)12/h2-3H,1H3 |
| InChIKey | HOMCRQATKGIJDA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |