C8H8F3NO3S — CID 174833873
(2,4-difluoro-3-methoxyphenyl)-fluoromethanesulfonamide (PubChem CID 174833873) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is (2,4-difluoro-3-methoxyphenyl)-fluoromethanesulfonamide.
| Compound Name | (2,4-difluoro-3-methoxyphenyl)-fluoromethanesulfonamide |
|---|---|
| PubChem CID | 174833873 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | (2,4-difluoro-3-methoxyphenyl)-fluoromethanesulfonamide |
| SMILES | COc1c(F)ccc(C(F)S(N)(=O)=O)c1F |
| InChI | InChI=1S/C8H8F3NO3S/c1-15-7-5(9)3-2-4(6(7)10)8(11)16(12,13)14/h2-3,8H,1H3,(H2,12,13,14) |
| InChIKey | UNZXYWAUPJRJDN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |