About 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone
1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone (PubChem CID 164895051) has the molecular formula C9H6F4O2
and a molecular weight of 222.14 g/mol. Its IUPAC name is 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone.
Analyze 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone?
The IUPAC name of 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone (CID 164895051) is 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone?
The canonical SMILES for 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone is COc1c(F)ccc(C(=O)C(F)F)c1F.
What is the InChIKey of 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone?
The InChIKey is NIWIFWIJJFMSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O2/c1-15-8-5(10)3-2-4(6(8)11)7(14)9(12)13/h2-3,9H,1H3.
What are the key properties of 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone?
1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone has a molecular weight of 222.14 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluoro-3-methoxyphenyl)-2,2-difluoroethanone is sourced from PubChem (CID 164895051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).