C7H4F4O2S — CID 57124852
hydroxy-methylidene-oxo-(2,3,4,5-tetrafluorophenyl)-λ6-sulfane (PubChem CID 57124852) has the molecular formula C7H4F4O2S and a molecular weight of 228.17 g/mol. Its IUPAC name is hydroxy-methylidene-oxo-(2,3,4,5-tetrafluorophenyl)-λ6-sulfane.
| Compound Name | hydroxy-methylidene-oxo-(2,3,4,5-tetrafluorophenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 57124852 |
| Molecular Formula | C7H4F4O2S |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | hydroxy-methylidene-oxo-(2,3,4,5-tetrafluorophenyl)-λ6-sulfane |
| SMILES | C=S(=O)(O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H4F4O2S/c1-14(12,13)4-2-3(8)5(9)7(11)6(4)10/h2H,1H2,(H,12,13) |
| InChIKey | ASDQUGJXEWVGIY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|