C12H13F4NO4S — CID 162751609
tert-butyl 2-[(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetate (PubChem CID 162751609) has the molecular formula C12H13F4NO4S and a molecular weight of 343.30 g/mol. Its IUPAC name is tert-butyl 2-[(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 162751609 |
| Molecular Formula | C12H13F4NO4S |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | tert-butyl 2-[(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F4NO4S/c1-12(2,3)21-8(18)5-17-22(19,20)7-4-6(13)9(14)11(16)10(7)15/h4,17H,5H2,1-3H3 |
| InChIKey | JTKKPVWZCZJIOQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|