C19H18F3NO8S — CID 16519826
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate (PubChem CID 16519826) has the molecular formula C19H18F3NO8S and a molecular weight of 477.41 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 16519826 |
| Molecular Formula | C19H18F3NO8S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
| SMILES | COc1cc(C(=O)COC(=O)CNS(=O)(=O)c2ccc(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C19H18F3NO8S/c1-28-13-6-10(7-14(29-2)19(13)30-3)12(24)9-31-16(25)8-23-32(26,27)15-5-4-11(20)17(21)18(15)22/h4-7,23H,8-9H2,1-3H3 |
| InChIKey | HCUANTGSJZLMKR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|