C22H19F3N2O5S — CID 17469437
N-(3,4-dimethoxyphenyl)-4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzamide (PubChem CID 17469437) has the molecular formula C22H19F3N2O5S and a molecular weight of 480.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 17469437 |
| Molecular Formula | C22H19F3N2O5S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(CNS(=O)(=O)c3ccc(F)c(F)c3F)cc2)cc1OC |
| InChI | InChI=1S/C22H19F3N2O5S/c1-31-17-9-7-15(11-18(17)32-2)27-22(28)14-5-3-13(4-6-14)12-26-33(29,30)19-10-8-16(23)20(24)21(19)25/h3-11,26H,12H2,1-2H3,(H,27,28) |
| InChIKey | ZDZBWIAUDDNBIN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|