C23H22F2N2O3 — CID 142928445
N-(4,5-difluoro-2-methylphenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide (PubChem CID 142928445) has the molecular formula C23H22F2N2O3 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-(4,5-difluoro-2-methylphenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide.
| Compound Name | N-(4,5-difluoro-2-methylphenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide |
|---|---|
| PubChem CID | 142928445 |
| Molecular Formula | C23H22F2N2O3 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(4,5-difluoro-2-methylphenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide |
| SMILES | COc1ccc(NCc2ccc(C(=O)Nc3cc(F)c(F)cc3C)cc2)cc1OC |
| InChI | InChI=1S/C23H22F2N2O3/c1-14-10-18(24)19(25)12-20(14)27-23(28)16-6-4-15(5-7-16)13-26-17-8-9-21(29-2)22(11-17)30-3/h4-12,26H,13H2,1-3H3,(H,27,28) |
| InChIKey | GXNXRLYGLMHLQW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|