C25H28N4O5 — CID 70810004
4-[(3,4-dimethoxyanilino)methyl]-N-[5-[(dimethylamino)methyl]-2-nitrophenyl]benzamide (PubChem CID 70810004) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyanilino)methyl]-N-[5-[(dimethylamino)methyl]-2-nitrophenyl]benzamide.
| Compound Name | 4-[(3,4-dimethoxyanilino)methyl]-N-[5-[(dimethylamino)methyl]-2-nitrophenyl]benzamide |
|---|---|
| PubChem CID | 70810004 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[(3,4-dimethoxyanilino)methyl]-N-[5-[(dimethylamino)methyl]-2-nitrophenyl]benzamide |
| SMILES | COc1ccc(NCc2ccc(C(=O)Nc3cc(CN(C)C)ccc3[N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C25H28N4O5/c1-28(2)16-18-7-11-22(29(31)32)21(13-18)27-25(30)19-8-5-17(6-9-19)15-26-20-10-12-23(33-3)24(14-20)34-4/h5-14,26H,15-16H2,1-4H3,(H,27,30) |
| InChIKey | DTAUWKWZFHWLIB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|