C28H26N2O4 — CID 59736811
4-[(3,4-dimethoxyanilino)methyl]-N-(2-hydroxy-5-phenylphenyl)benzamide (PubChem CID 59736811) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyanilino)methyl]-N-(2-hydroxy-5-phenylphenyl)benzamide.
| Compound Name | 4-[(3,4-dimethoxyanilino)methyl]-N-(2-hydroxy-5-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 59736811 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[(3,4-dimethoxyanilino)methyl]-N-(2-hydroxy-5-phenylphenyl)benzamide |
| SMILES | COc1ccc(NCc2ccc(C(=O)Nc3cc(-c4ccccc4)ccc3O)cc2)cc1OC |
| InChI | InChI=1S/C28H26N2O4/c1-33-26-15-13-23(17-27(26)34-2)29-18-19-8-10-21(11-9-19)28(32)30-24-16-22(12-14-25(24)31)20-6-4-3-5-7-20/h3-17,29,31H,18H2,1-2H3,(H,30,32) |
| InChIKey | GNXPPUZNHVIZIR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|