C25H26N4O4 — CID 66893261
N-[2-amino-5-(3-amino-3-oxoprop-1-enyl)phenyl]-4-[(3,4-dimethoxyanilino)methyl]benzamide (PubChem CID 66893261) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2-amino-5-(3-amino-3-oxoprop-1-enyl)phenyl]-4-[(3,4-dimethoxyanilino)methyl]benzamide.
| Compound Name | N-[2-amino-5-(3-amino-3-oxoprop-1-enyl)phenyl]-4-[(3,4-dimethoxyanilino)methyl]benzamide |
|---|---|
| PubChem CID | 66893261 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[2-amino-5-(3-amino-3-oxoprop-1-enyl)phenyl]-4-[(3,4-dimethoxyanilino)methyl]benzamide |
| SMILES | COc1ccc(NCc2ccc(C(=O)Nc3cc(C=CC(N)=O)ccc3N)cc2)cc1OC |
| InChI | InChI=1S/C25H26N4O4/c1-32-22-11-9-19(14-23(22)33-2)28-15-17-3-7-18(8-4-17)25(31)29-21-13-16(5-10-20(21)26)6-12-24(27)30/h3-14,28H,15,26H2,1-2H3,(H2,27,30)(H,29,31) |
| InChIKey | SHTLJGXSHJTBDJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|