C16H19N3O3 — CID 70810026
4-[(3,4-dimethoxyanilino)methyl]benzohydrazide (PubChem CID 70810026) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyanilino)methyl]benzohydrazide.
| Compound Name | 4-[(3,4-dimethoxyanilino)methyl]benzohydrazide |
|---|---|
| PubChem CID | 70810026 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-[(3,4-dimethoxyanilino)methyl]benzohydrazide |
| SMILES | COc1ccc(NCc2ccc(C(=O)NN)cc2)cc1OC |
| InChI | InChI=1S/C16H19N3O3/c1-21-14-8-7-13(9-15(14)22-2)18-10-11-3-5-12(6-4-11)16(20)19-17/h3-9,18H,10,17H2,1-2H3,(H,19,20) |
| InChIKey | RRJCUQZPUYTLAX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|