C29H25N5O2 — CID 71471337
N-(2-amino-5-phenylphenyl)-4-[[(8-methoxyquinazolin-4-yl)amino]methyl]benzamide (PubChem CID 71471337) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[[(8-methoxyquinazolin-4-yl)amino]methyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[[(8-methoxyquinazolin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 71471337 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[[(8-methoxyquinazolin-4-yl)amino]methyl]benzamide |
| SMILES | COc1cccc2c(NCc3ccc(C(=O)Nc4cc(-c5ccccc5)ccc4N)cc3)ncnc12 |
| InChI | InChI=1S/C29H25N5O2/c1-36-26-9-5-8-23-27(26)32-18-33-28(23)31-17-19-10-12-21(13-11-19)29(35)34-25-16-22(14-15-24(25)30)20-6-3-2-4-7-20/h2-16,18H,17,30H2,1H3,(H,34,35)(H,31,32,33) |
| InChIKey | BITDNCOAWBVVQB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|