C18H17F3N2O5S — CID 18208030
[2-(2,4-dimethylanilino)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate (PubChem CID 18208030) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is [2-(2,4-dimethylanilino)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 18208030 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CNS(=O)(=O)c2ccc(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C18H17F3N2O5S/c1-10-3-5-13(11(2)7-10)23-15(24)9-28-16(25)8-22-29(26,27)14-6-4-12(19)17(20)18(14)21/h3-7,22H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | ALOVZJWJMBDFBM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|