C16H24N2O5S — CID 22456229
tert-butyl 2-[[4-(2-methylpropanoylamino)phenyl]sulfonylamino]acetate (PubChem CID 22456229) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is tert-butyl 2-[[4-(2-methylpropanoylamino)phenyl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[4-(2-methylpropanoylamino)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 22456229 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | tert-butyl 2-[[4-(2-methylpropanoylamino)phenyl]sulfonylamino]acetate |
| SMILES | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O5S/c1-11(2)15(20)18-12-6-8-13(9-7-12)24(21,22)17-10-14(19)23-16(3,4)5/h6-9,11,17H,10H2,1-5H3,(H,18,20) |
| InChIKey | JWBFBDWVUIVXLC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |