C26H28N2O6S — CID 22456308
tert-butyl 2-[[4-[(2-phenylmethoxybenzoyl)amino]phenyl]sulfonylamino]acetate (PubChem CID 22456308) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(2-phenylmethoxybenzoyl)amino]phenyl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[4-[(2-phenylmethoxybenzoyl)amino]phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 22456308 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | tert-butyl 2-[[4-[(2-phenylmethoxybenzoyl)amino]phenyl]sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1ccc(NC(=O)c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-26(2,3)34-24(29)17-27-35(31,32)21-15-13-20(14-16-21)28-25(30)22-11-7-8-12-23(22)33-18-19-9-5-4-6-10-19/h4-16,27H,17-18H2,1-3H3,(H,28,30) |
| InChIKey | HIYQSFPUJDPBIR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |