C19H28N2O5S — CID 22456406
tert-butyl 2-[[4-(cyclohexanecarbonylamino)phenyl]sulfonylamino]acetate (PubChem CID 22456406) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is tert-butyl 2-[[4-(cyclohexanecarbonylamino)phenyl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[4-(cyclohexanecarbonylamino)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 22456406 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | tert-butyl 2-[[4-(cyclohexanecarbonylamino)phenyl]sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-19(2,3)26-17(22)13-20-27(24,25)16-11-9-15(10-12-16)21-18(23)14-7-5-4-6-8-14/h9-12,14,20H,4-8,13H2,1-3H3,(H,21,23) |
| InChIKey | IOKISHJPHUELKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |