C10H8BrF2NO4S — CID 105115653
3-(2-bromoprop-2-enylsulfamoyl)-4,5-difluorobenzoic acid (PubChem CID 105115653) has the molecular formula C10H8BrF2NO4S and a molecular weight of 356.14 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enylsulfamoyl)-4,5-difluorobenzoic acid.
| Compound Name | 3-(2-bromoprop-2-enylsulfamoyl)-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 105115653 |
| Molecular Formula | C10H8BrF2NO4S |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 3-(2-bromoprop-2-enylsulfamoyl)-4,5-difluorobenzoic acid |
| SMILES | C=C(Br)CNS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C10H8BrF2NO4S/c1-5(11)4-14-19(17,18)8-3-6(10(15)16)2-7(12)9(8)13/h2-3,14H,1,4H2,(H,15,16) |
| InChIKey | NDBPBQRGKMWCMK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |