C9H9BrClFN2O4S — CID 103077167
methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]acetate (PubChem CID 103077167) has the molecular formula C9H9BrClFN2O4S and a molecular weight of 375.60 g/mol. Its IUPAC name is methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]acetate.
| Compound Name | methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 103077167 |
| Molecular Formula | C9H9BrClFN2O4S |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C9H9BrClFN2O4S/c1-18-6(15)3-14-19(16,17)5-2-4(11)7(10)9(13)8(5)12/h2,14H,3,13H2,1H3 |
| InChIKey | GSSZRUAMGJSEEG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|