C9H8ClF2NO4S — CID 59591393
3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzoic acid (PubChem CID 59591393) has the molecular formula C9H8ClF2NO4S and a molecular weight of 299.68 g/mol. Its IUPAC name is 3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzoic acid.
| Compound Name | 3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 59591393 |
| Molecular Formula | C9H8ClF2NO4S |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzoic acid |
| SMILES | CCNS(=O)(=O)c1cc(C(=O)O)c(F)c(Cl)c1F |
| InChI | InChI=1S/C9H8ClF2NO4S/c1-2-13-18(16,17)5-3-4(9(14)15)7(11)6(10)8(5)12/h3,13H,2H2,1H3,(H,14,15) |
| InChIKey | AZDVUQXPLQFCMF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|