C15H17ClF2N4O3S2 — CID 24959828
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzamide (PubChem CID 24959828) has the molecular formula C15H17ClF2N4O3S2 and a molecular weight of 438.91 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 24959828 |
| Molecular Formula | C15H17ClF2N4O3S2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-chloro-5-(ethylsulfamoyl)-2,4-difluorobenzamide |
| SMILES | CCNS(=O)(=O)c1cc(C(=O)Nc2nnc(C(C)(C)C)s2)c(F)c(Cl)c1F |
| InChI | InChI=1S/C15H17ClF2N4O3S2/c1-5-19-27(24,25)8-6-7(10(17)9(16)11(8)18)12(23)20-14-22-21-13(26-14)15(2,3)4/h6,19H,5H2,1-4H3,(H,20,22,23) |
| InChIKey | OEAKEHAWPNEVFL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|