About 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride
2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride (PubChem CID 160658516) has the molecular formula C18H11Cl5F2O5
and a molecular weight of 522.54 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride.
Molecular Properties
| Compound Name | 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride |
| PubChem CID | 160658516 |
| Molecular Formula | C18H11Cl5F2O5 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 519.90 |
| IUPAC Name | 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride |
| SMILES | Cc1cc(C(=O)Cl)c(Cl)cc1F.Cc1cc(C(=O)O)c(Cl)cc1F.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C8H5Cl2FO.C8H6ClFO2.C2Cl2O2/c1-4-2-5(8(10)12)6(9)3-7(4)11;1-4-2-5(8(11)12)6(9)3-7(4)10;3-1(5)2(4)6/h2-3H,1H3;2-3H,1H3,(H,11,12); |
| InChIKey | RLJBLRZCVBJBFF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride?
The IUPAC name of 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride (CID 160658516) is 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride.
What is the SMILES notation for 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride?
The canonical SMILES for 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride is Cc1cc(C(=O)Cl)c(Cl)cc1F.Cc1cc(C(=O)O)c(Cl)cc1F.O=C(Cl)C(=O)Cl.
What is the InChIKey of 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride?
The InChIKey is RLJBLRZCVBJBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2FO.C8H6ClFO2.C2Cl2O2/c1-4-2-5(8(10)12)6(9)3-7(4)11;1-4-2-5(8(11)12)6(9)3-7(4)10;3-1(5)2(4)6/h2-3H,1H3;2-3H,1H3,(H,11,12);.
What are the key properties of 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride?
2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride has a molecular weight of 522.54 g/mol, XLogP of 6.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-fluoro-5-methylbenzoic acid;2-chloro-4-fluoro-5-methylbenzoyl chloride;oxalyl dichloride is sourced from PubChem (CID 160658516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).