2-bromo-4-fluoro-5-methylbenzoyl chloride

C8H5BrClFO — CID 171033249

IUPAC2-bromo-4-fluoro-5-methylbenzoyl chloride
SMILESCc1cc(C(=O)Cl)c(Br)cc1F
InChIInChI=1S/C8H5BrClFO/c1-4-2-5(8(10)12)6(9)3-7(4)11/h2-3H,1H3
InChIKeyGBUQPKZASAKNHG-UHFFFAOYSA-N
MW251.48 g/mol
LogP3.28
Rot. Bonds1

About 2-bromo-4-fluoro-5-methylbenzoyl chloride

2-bromo-4-fluoro-5-methylbenzoyl chloride (PubChem CID 171033249) has the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. Its IUPAC name is 2-bromo-4-fluoro-5-methylbenzoyl chloride.

Molecular Properties

Compound Name2-bromo-4-fluoro-5-methylbenzoyl chloride
PubChem CID171033249
Molecular FormulaC8H5BrClFO
Molecular Weight251.48 g/mol
Exact Mass249.92
IUPAC Name2-bromo-4-fluoro-5-methylbenzoyl chloride
SMILESCc1cc(C(=O)Cl)c(Br)cc1F
InChIInChI=1S/C8H5BrClFO/c1-4-2-5(8(10)12)6(9)3-7(4)11/h2-3H,1H3
InChIKeyGBUQPKZASAKNHG-UHFFFAOYSA-N
XLogP3.28
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.48
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-bromo-4-fluoro-5-methylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-4-fluoro-5-methylbenzoyl chloride?
The IUPAC name of 2-bromo-4-fluoro-5-methylbenzoyl chloride (CID 171033249) is 2-bromo-4-fluoro-5-methylbenzoyl chloride.
What is the SMILES notation for 2-bromo-4-fluoro-5-methylbenzoyl chloride?
The canonical SMILES for 2-bromo-4-fluoro-5-methylbenzoyl chloride is Cc1cc(C(=O)Cl)c(Br)cc1F.
What is the InChIKey of 2-bromo-4-fluoro-5-methylbenzoyl chloride?
The InChIKey is GBUQPKZASAKNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrClFO/c1-4-2-5(8(10)12)6(9)3-7(4)11/h2-3H,1H3.
What are the key properties of 2-bromo-4-fluoro-5-methylbenzoyl chloride?
2-bromo-4-fluoro-5-methylbenzoyl chloride has a molecular weight of 251.48 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-fluoro-5-methylbenzoyl chloride is sourced from PubChem (CID 171033249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).