C12H3Cl5FI — CID 134628174
1,2,3,4,5-pentachloro-6-(4-fluoro-2-iodophenyl)benzene (PubChem CID 134628174) has the molecular formula C12H3Cl5FI and a molecular weight of 470.32 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-(4-fluoro-2-iodophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-(4-fluoro-2-iodophenyl)benzene |
|---|---|
| PubChem CID | 134628174 |
| Molecular Formula | C12H3Cl5FI |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 467.77 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-(4-fluoro-2-iodophenyl)benzene |
| SMILES | Fc1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(I)c1 |
| InChI | InChI=1S/C12H3Cl5FI/c13-8-7(5-2-1-4(18)3-6(5)19)9(14)11(16)12(17)10(8)15/h1-3H |
| InChIKey | ARIUHMFZKAYCEU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|