C13H5Cl4FO2 — CID 105349853
5-fluoro-2-(2,3,4,6-tetrachlorophenyl)benzoic acid (PubChem CID 105349853) has the molecular formula C13H5Cl4FO2 and a molecular weight of 353.99 g/mol. Its IUPAC name is 5-fluoro-2-(2,3,4,6-tetrachlorophenyl)benzoic acid.
| Compound Name | 5-fluoro-2-(2,3,4,6-tetrachlorophenyl)benzoic acid |
|---|---|
| PubChem CID | 105349853 |
| Molecular Formula | C13H5Cl4FO2 |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 351.90 |
| IUPAC Name | 5-fluoro-2-(2,3,4,6-tetrachlorophenyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1-c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl4FO2/c14-8-4-9(15)11(16)12(17)10(8)6-2-1-5(18)3-7(6)13(19)20/h1-4H,(H,19,20) |
| InChIKey | MFTLYXMDJBQTDO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|