C13H7Cl5FN — CID 134631525
[5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]methanamine (PubChem CID 134631525) has the molecular formula C13H7Cl5FN and a molecular weight of 373.47 g/mol. Its IUPAC name is [5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]methanamine.
| Compound Name | [5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 134631525 |
| Molecular Formula | C13H7Cl5FN |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 370.90 |
| IUPAC Name | [5-fluoro-2-(2,3,4,5,6-pentachlorophenyl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl5FN/c14-9-8(10(15)12(17)13(18)11(9)16)7-2-1-6(19)3-5(7)4-20/h1-3H,4,20H2 |
| InChIKey | DUXOHXVDRQCWHF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|