C13H9Cl2F2N — CID 82107310
[2,6-dichloro-3-(2,4-difluorophenyl)phenyl]methanamine (PubChem CID 82107310) has the molecular formula C13H9Cl2F2N and a molecular weight of 288.12 g/mol. Its IUPAC name is [2,6-dichloro-3-(2,4-difluorophenyl)phenyl]methanamine.
| Compound Name | [2,6-dichloro-3-(2,4-difluorophenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 82107310 |
| Molecular Formula | C13H9Cl2F2N |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | [2,6-dichloro-3-(2,4-difluorophenyl)phenyl]methanamine |
| SMILES | NCc1c(Cl)ccc(-c2ccc(F)cc2F)c1Cl |
| InChI | InChI=1S/C13H9Cl2F2N/c14-11-4-3-9(13(15)10(11)6-18)8-2-1-7(16)5-12(8)17/h1-5H,6,18H2 |
| InChIKey | RHIXMIHURSWHMY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |